C20H32N8S — CID 111933247
1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111933247) has the molecular formula C20H32N8S and a molecular weight of 416.60 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111933247 |
| Molecular Formula | C20H32N8S |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCN(c2ncccn2)CC1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C20H32N8S/c1-3-21-19(23-10-6-18-16-29-17(2)26-18)22-9-5-11-27-12-14-28(15-13-27)20-24-7-4-8-25-20/h4,7-8,16H,3,5-6,9-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | JSYITWIUBXBONI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|