C18H22F3IN6S — CID 111616323
1-[3-(benzimidazol-1-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616323) has the molecular formula C18H22F3IN6S and a molecular weight of 538.38 g/mol. Its IUPAC name is 1-[3-(benzimidazol-1-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(benzimidazol-1-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616323 |
| Molecular Formula | C18H22F3IN6S |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 1-[3-(benzimidazol-1-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCn1cnc2ccccc21.I |
| InChI | InChI=1S/C18H21F3N6S.HI/c1-2-22-17(24-10-16-26-15(11-28-16)18(19,20)21)23-8-5-9-27-12-25-13-6-3-4-7-14(13)27;/h3-4,6-7,11-12H,2,5,8-10H2,1H3,(H2,22,23,24);1H |
| InChIKey | BSROYHBLMFFADD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|