C22H31IN6S — CID 109424791
3-ethyl-1-methyl-2-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109424791) has the molecular formula C22H31IN6S and a molecular weight of 538.50 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109424791 |
| Molecular Formula | C22H31IN6S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 3-ethyl-1-methyl-2-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cn(-c2ccccc2)nc1C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C22H30N6S.HI/c1-5-23-22(27(4)15-20-16-29-18(3)25-20)24-13-9-10-19-14-28(26-17(19)2)21-11-7-6-8-12-21;/h6-8,11-12,14,16H,5,9-10,13,15H2,1-4H3,(H,23,24);1H |
| InChIKey | PJHLKCXHBZXRJK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|