C18H26N6OS — CID 109421182
3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 109421182) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 109421182 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1cccc(C)n1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H26N6OS/c1-5-19-18(24(4)11-15-12-26-14(3)22-15)20-10-9-17(25)23-16-8-6-7-13(2)21-16/h6-8,12H,5,9-11H2,1-4H3,(H,19,20)(H,21,23,25) |
| InChIKey | HUPQLBCCUYRHOB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|