C22H32IN5O3 — CID 111297308
3-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111297308) has the molecular formula C22H32IN5O3 and a molecular weight of 541.43 g/mol. Its IUPAC name is 3-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111297308 |
| Molecular Formula | C22H32IN5O3 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 3-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)Nc1cccc(C)n1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C22H31N5O3.HI/c1-6-23-22(24-13-12-21(28)26-20-9-7-8-16(2)25-20)27(3)15-17-10-11-18(29-4)14-19(17)30-5;/h7-11,14H,6,12-13,15H2,1-5H3,(H,23,24)(H,25,26,28);1H |
| InChIKey | BXUVTEOQQLTKQN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|