C23H32FIN4O3 — CID 111297400
N-[2-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111297400) has the molecular formula C23H32FIN4O3 and a molecular weight of 558.44 g/mol. Its IUPAC name is N-[2-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111297400 |
| Molecular Formula | C23H32FIN4O3 |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | N-[2-[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)Cc1ccc(F)cc1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C23H31FN4O3.HI/c1-5-25-23(28(2)16-18-8-11-20(30-3)15-21(18)31-4)27-13-12-26-22(29)14-17-6-9-19(24)10-7-17;/h6-11,15H,5,12-14,16H2,1-4H3,(H,25,27)(H,26,29);1H |
| InChIKey | LAAFTRUGWCMOHF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|