C22H30FN3O4 — CID 111297347
1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylguanidine (PubChem CID 111297347) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylguanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111297347 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C22H30FN3O4/c1-5-24-22(25-13-18(27)15-30-19-10-7-17(23)8-11-19)26(2)14-16-6-9-20(28-3)12-21(16)29-4/h6-12,18,27H,5,13-15H2,1-4H3,(H,24,25) |
| InChIKey | WVEITJQKPZTHJZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|