C19H26ClN5OS — CID 109423728
N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]propanamide (PubChem CID 109423728) has the molecular formula C19H26ClN5OS and a molecular weight of 407.97 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]propanamide |
|---|---|
| PubChem CID | 109423728 |
| Molecular Formula | C19H26ClN5OS |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cc1Cl)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C19H26ClN5OS/c1-5-21-19(25(4)11-15-12-27-14(3)23-15)22-9-8-18(26)24-17-7-6-13(2)10-16(17)20/h6-7,10,12H,5,8-9,11H2,1-4H3,(H,21,22)(H,24,26) |
| InChIKey | YOFXVJKNWAFJEZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|