C18H24ClN5OS — CID 109421326
4-chloro-N-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]benzamide (PubChem CID 109421326) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is 4-chloro-N-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109421326 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-chloro-N-[2-[[ethylamino-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methylidene]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(Cl)cc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H24ClN5OS/c1-4-20-18(24(3)11-16-12-26-13(2)23-16)22-10-9-21-17(25)14-5-7-15(19)8-6-14/h5-8,12H,4,9-11H2,1-3H3,(H,20,22)(H,21,25) |
| InChIKey | GXFXQWHSGKYXRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|