C19H26N6S — CID 111088817
N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111088817) has the molecular formula C19H26N6S and a molecular weight of 370.53 g/mol. Its IUPAC name is N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111088817 |
| Molecular Formula | C19H26N6S |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CC1Cc2ccccc2N1CC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H26N6S/c1-15-14-16-4-2-3-5-17(16)25(15)8-6-21-18(20)23-9-11-24(12-10-23)19-22-7-13-26-19/h2-5,7,13,15H,6,8-12,14H2,1H3,(H2,20,21) |
| InChIKey | IMCXWZMAAOQFPY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|