C16H16N2O — CID 2984117
(4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 2984117) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 2984117 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16N2O/c17-14-9-7-13(8-10-14)16(19)18-11-3-5-12-4-1-2-6-15(12)18/h1-2,4,6-10H,3,5,11,17H2 |
| InChIKey | KZYCNMIZJOEZLC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|