C15H16N2O — CID 110762715
3,4-dihydro-2H-quinolin-1-yl-(1-methylpyrrol-3-yl)methanone (PubChem CID 110762715) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-(1-methylpyrrol-3-yl)methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-(1-methylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 110762715 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-(1-methylpyrrol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C15H16N2O/c1-16-10-8-13(11-16)15(18)17-9-4-6-12-5-2-3-7-14(12)17/h2-3,5,7-8,10-11H,4,6,9H2,1H3 |
| InChIKey | KBDJVWRSJHKSMR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |