C17H18N2O — CID 10587836
(4-aminophenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone (PubChem CID 10587836) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (4-aminophenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone.
| Compound Name | (4-aminophenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
|---|---|
| PubChem CID | 10587836 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (4-aminophenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCCCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18N2O/c18-15-10-8-14(9-11-15)17(20)19-12-4-3-6-13-5-1-2-7-16(13)19/h1-2,5,7-11H,3-4,6,12,18H2 |
| InChIKey | RSEFMSOKHZWZHB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|