C17H15N3O — CID 58794290
(3-amino-4-isocyanophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 58794290) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is (3-amino-4-isocyanophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (3-amino-4-isocyanophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 58794290 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3-amino-4-isocyanophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | [C-]#[N+]c1ccc(C(=O)N2CCCc3ccccc32)cc1N |
| InChI | InChI=1S/C17H15N3O/c1-19-15-9-8-13(11-14(15)18)17(21)20-10-4-6-12-5-2-3-7-16(12)20/h2-3,5,7-9,11H,4,6,10,18H2 |
| InChIKey | BHHIRQBSVBHBHG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|