C19H20N4O2 — CID 5209307
4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxo-N-(pyridin-3-ylmethylideneamino)butanamide (PubChem CID 5209307) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxo-N-(pyridin-3-ylmethylideneamino)butanamide.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxo-N-(pyridin-3-ylmethylideneamino)butanamide |
|---|---|
| PubChem CID | 5209307 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxo-N-(pyridin-3-ylmethylideneamino)butanamide |
| SMILES | O=C(CCC(=O)N1CCCc2ccccc21)NN=Cc1cccnc1 |
| InChI | InChI=1S/C19H20N4O2/c24-18(22-21-14-15-5-3-11-20-13-15)9-10-19(25)23-12-4-7-16-6-1-2-8-17(16)23/h1-3,5-6,8,11,13-14H,4,7,9-10,12H2,(H,22,24) |
| InChIKey | HONXYRAAZCRJRI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|