C21H21N3O4 — CID 5209504
N-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanamide (PubChem CID 5209504) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 5209504 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-4-(3,4-dihydro-2H-quinolin-1-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCCc2ccccc21)NN=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N3O4/c25-20(23-22-13-15-7-8-18-19(12-15)28-14-27-18)9-10-21(26)24-11-3-5-16-4-1-2-6-17(16)24/h1-2,4,6-8,12-13H,3,5,9-11,14H2,(H,23,25) |
| InChIKey | GMVFEJLHTQCVFN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|