C17H16FNOS — CID 107031389
(2-fluoro-5-sulfanylphenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone (PubChem CID 107031389) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is (2-fluoro-5-sulfanylphenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone.
| Compound Name | (2-fluoro-5-sulfanylphenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
|---|---|
| PubChem CID | 107031389 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (2-fluoro-5-sulfanylphenyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
| SMILES | O=C(c1cc(S)ccc1F)N1CCCCc2ccccc21 |
| InChI | InChI=1S/C17H16FNOS/c18-15-9-8-13(21)11-14(15)17(20)19-10-4-3-6-12-5-1-2-7-16(12)19/h1-2,5,7-9,11,21H,3-4,6,10H2 |
| InChIKey | PKQGOJHLNFYNCF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|