C16H14ClFN2O — CID 103893098
(2-chloro-5-fluoro-3-pyridinyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone (PubChem CID 103893098) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is (2-chloro-5-fluoro-3-pyridinyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone.
| Compound Name | (2-chloro-5-fluoro-3-pyridinyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
|---|---|
| PubChem CID | 103893098 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (2-chloro-5-fluoro-3-pyridinyl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
| SMILES | O=C(c1cc(F)cnc1Cl)N1CCCCc2ccccc21 |
| InChI | InChI=1S/C16H14ClFN2O/c17-15-13(9-12(18)10-19-15)16(21)20-8-4-3-6-11-5-1-2-7-14(11)20/h1-2,5,7,9-10H,3-4,6,8H2 |
| InChIKey | YVECEWDADSSZDM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|