C14H10ClFN2O2 — CID 103891964
(2-chloro-5-fluoro-3-pyridinyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone (PubChem CID 103891964) has the molecular formula C14H10ClFN2O2 and a molecular weight of 292.70 g/mol. Its IUPAC name is (2-chloro-5-fluoro-3-pyridinyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone.
| Compound Name | (2-chloro-5-fluoro-3-pyridinyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
|---|---|
| PubChem CID | 103891964 |
| Molecular Formula | C14H10ClFN2O2 |
| Molecular Weight | 292.70 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (2-chloro-5-fluoro-3-pyridinyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
| SMILES | O=C(c1cc(F)cnc1Cl)N1CCOc2ccccc21 |
| InChI | InChI=1S/C14H10ClFN2O2/c15-13-10(7-9(16)8-17-13)14(19)18-5-6-20-12-4-2-1-3-11(12)18/h1-4,7-8H,5-6H2 |
| InChIKey | RULOFHOKWWRCLX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|