C15H15NOS2 — CID 107031393
(4-sulfanylthiophen-2-yl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone (PubChem CID 107031393) has the molecular formula C15H15NOS2 and a molecular weight of 289.43 g/mol. Its IUPAC name is (4-sulfanylthiophen-2-yl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone.
| Compound Name | (4-sulfanylthiophen-2-yl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
|---|---|
| PubChem CID | 107031393 |
| Molecular Formula | C15H15NOS2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (4-sulfanylthiophen-2-yl)-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)methanone |
| SMILES | O=C(c1cc(S)cs1)N1CCCCc2ccccc21 |
| InChI | InChI=1S/C15H15NOS2/c17-15(14-9-12(18)10-19-14)16-8-4-3-6-11-5-1-2-7-13(11)16/h1-2,5,7,9-10,18H,3-4,6,8H2 |
| InChIKey | APCCOMPFNJORNN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|