C16H14BrNOS — CID 107021560
(4-bromo-2-sulfanylphenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 107021560) has the molecular formula C16H14BrNOS and a molecular weight of 348.27 g/mol. Its IUPAC name is (4-bromo-2-sulfanylphenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (4-bromo-2-sulfanylphenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 107021560 |
| Molecular Formula | C16H14BrNOS |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (4-bromo-2-sulfanylphenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1S)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H14BrNOS/c17-12-7-8-13(15(20)10-12)16(19)18-9-3-5-11-4-1-2-6-14(11)18/h1-2,4,6-8,10,20H,3,5,9H2 |
| InChIKey | LSMLSPBGAQQIQQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|