C22H21BrN2O — CID 25181238
[5-bromo-2-(2,5-dimethylpyrrol-1-yl)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 25181238) has the molecular formula C22H21BrN2O and a molecular weight of 409.33 g/mol. Its IUPAC name is [5-bromo-2-(2,5-dimethylpyrrol-1-yl)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [5-bromo-2-(2,5-dimethylpyrrol-1-yl)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 25181238 |
| Molecular Formula | C22H21BrN2O |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [5-bromo-2-(2,5-dimethylpyrrol-1-yl)phenyl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(Br)cc1C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H21BrN2O/c1-15-9-10-16(2)25(15)21-12-11-18(23)14-19(21)22(26)24-13-5-7-17-6-3-4-8-20(17)24/h3-4,6,8-12,14H,5,7,13H2,1-2H3 |
| InChIKey | PNPYTVVVCAYNGW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|