C17H16N2O3 — CID 108502677
2-(2,3-dihydroindol-1-yl)-N-(4-methoxyphenyl)-2-oxoacetamide (PubChem CID 108502677) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-(4-methoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-(4-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108502677 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-(4-methoxyphenyl)-2-oxoacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H16N2O3/c1-22-14-8-6-13(7-9-14)18-16(20)17(21)19-11-10-12-4-2-3-5-15(12)19/h2-9H,10-11H2,1H3,(H,18,20) |
| InChIKey | HKHZIBCZWAOBLN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|