C15H17N — CID 145056471
1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole (PubChem CID 145056471) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole.
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 145056471 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole |
| SMILES | C=C/C=C(\C=C)CN1CCc2ccccc21 |
| InChI | InChI=1S/C15H17N/c1-3-7-13(4-2)12-16-11-10-14-8-5-6-9-15(14)16/h3-9H,1-2,10-12H2/b13-7+ |
| InChIKey | BWMVUHKSQKBOJH-NTUHNPAUSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|