C16H20N2O2 — CID 145056470
1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole;nitromethane (PubChem CID 145056470) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole;nitromethane.
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole;nitromethane |
|---|---|
| PubChem CID | 145056470 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-2,3-dihydroindole;nitromethane |
| SMILES | C=C/C=C(\C=C)CN1CCc2ccccc21.C[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N.CH3NO2/c1-3-7-13(4-2)12-16-11-10-14-8-5-6-9-15(14)16;1-2(3)4/h3-9H,1-2,10-12H2;1H3/b13-7+; |
| InChIKey | UQRSUCHRCAVCRC-FTPOTTDRSA-N |
| XLogP | 3.24 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|