C13H15NO — CID 63912554
1-cyclopropyl-2-(2,3-dihydroindol-1-yl)ethanone (PubChem CID 63912554) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-cyclopropyl-2-(2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 63912554 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-cyclopropyl-2-(2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CN1CCc2ccccc21)C1CC1 |
| InChI | InChI=1S/C13H15NO/c15-13(11-5-6-11)9-14-8-7-10-3-1-2-4-12(10)14/h1-4,11H,5-9H2 |
| InChIKey | NSUCIXOXLCWAAT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |