C22H24N2O4 — CID 69185939
1-[4-[(2-oxo-3,4-dihydroquinolin-1-yl)oxy]butoxy]-3,4-dihydroquinolin-2-one (PubChem CID 69185939) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-[4-[(2-oxo-3,4-dihydroquinolin-1-yl)oxy]butoxy]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[4-[(2-oxo-3,4-dihydroquinolin-1-yl)oxy]butoxy]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 69185939 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[4-[(2-oxo-3,4-dihydroquinolin-1-yl)oxy]butoxy]-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1OCCCCON1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C22H24N2O4/c25-21-13-11-17-7-1-3-9-19(17)23(21)27-15-5-6-16-28-24-20-10-4-2-8-18(20)12-14-22(24)26/h1-4,7-10H,5-6,11-16H2 |
| InChIKey | DXQQPZNOFRTEDW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|