C12H13ClN2O3 — CID 57023332
1-(3-chloro-2-nitrosopropoxy)-3,4-dihydroquinolin-2-one (PubChem CID 57023332) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 1-(3-chloro-2-nitrosopropoxy)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(3-chloro-2-nitrosopropoxy)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 57023332 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(3-chloro-2-nitrosopropoxy)-3,4-dihydroquinolin-2-one |
| SMILES | O=NC(CCl)CON1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C12H13ClN2O3/c13-7-10(14-17)8-18-15-11-4-2-1-3-9(11)5-6-12(15)16/h1-4,10H,5-8H2 |
| InChIKey | OICVXRYEPFPPTJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|