C16H23N3O3 — CID 57051183
1-[3-tert-butylimino-2-(hydroxyamino)propoxy]-3,4-dihydroquinolin-2-one (PubChem CID 57051183) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[3-tert-butylimino-2-(hydroxyamino)propoxy]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[3-tert-butylimino-2-(hydroxyamino)propoxy]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 57051183 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[3-tert-butylimino-2-(hydroxyamino)propoxy]-3,4-dihydroquinolin-2-one |
| SMILES | CC(C)(C)/N=C/C(CON1C(=O)CCc2ccccc21)NO |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)17-10-13(18-21)11-22-19-14-7-5-4-6-12(14)8-9-15(19)20/h4-7,10,13,18,21H,8-9,11H2,1-3H3/b17-10+ |
| InChIKey | LTMXYRQVRIPPSU-LICLKQGHSA-N |
| XLogP | 2.11 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|