C10H13ClN2O2 — CID 67793338
1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride (PubChem CID 67793338) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride.
| Compound Name | 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 67793338 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride |
| SMILES | Cl.NCON1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2.ClH/c11-7-14-12-9-4-2-1-3-8(9)5-6-10(12)13;/h1-4H,5-7,11H2;1H |
| InChIKey | WMINXFOEXKCUNS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|