About 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride
1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride (PubChem CID 67793338) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride |
| PubChem CID | 67793338 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride |
| SMILES | Cl.NCON1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2.ClH/c11-7-14-12-9-4-2-1-3-8(9)5-6-10(12)13;/h1-4H,5-7,11H2;1H |
| InChIKey | WMINXFOEXKCUNS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride?
The IUPAC name of 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride (CID 67793338) is 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride.
What is the SMILES notation for 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride?
The canonical SMILES for 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride is Cl.NCON1C(=O)CCc2ccccc21.
What is the InChIKey of 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride?
The InChIKey is WMINXFOEXKCUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2.ClH/c11-7-14-12-9-4-2-1-3-8(9)5-6-10(12)13;/h1-4H,5-7,11H2;1H.
What are the key properties of 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride?
1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride has a molecular weight of 228.68 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethoxy)-3,4-dihydroquinolin-2-one;hydrochloride is sourced from PubChem (CID 67793338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).