C17H16ClNO — CID 125472514
2-chloro-1-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)ethanone (PubChem CID 125472514) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-chloro-1-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)ethanone.
| Compound Name | 2-chloro-1-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)ethanone |
|---|---|
| PubChem CID | 125472514 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-chloro-1-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)ethanone |
| SMILES | O=C(CCl)N1Cc2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H16ClNO/c18-11-17(20)19-12-15-7-2-1-5-13(15)9-10-14-6-3-4-8-16(14)19/h1-8H,9-12H2 |
| InChIKey | IJZNGRNZBRDVLB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|