C21H23N3OS — CID 22072548
1-[4-(4-methylbenzenecarbothioyl)piperazin-1-yl]-3,4-dihydroquinolin-2-one (PubChem CID 22072548) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-[4-(4-methylbenzenecarbothioyl)piperazin-1-yl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[4-(4-methylbenzenecarbothioyl)piperazin-1-yl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 22072548 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-[4-(4-methylbenzenecarbothioyl)piperazin-1-yl]-3,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc(C(=S)N2CCN(N3C(=O)CCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C21H23N3OS/c1-16-6-8-18(9-7-16)21(26)22-12-14-23(15-13-22)24-19-5-3-2-4-17(19)10-11-20(24)25/h2-9H,10-15H2,1H3 |
| InChIKey | FLBOEEAKULHUNH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|