C18H17NO4 — CID 139623169
1-(3,4-dimethoxybenzoyl)-3,4-dihydroquinolin-2-one (PubChem CID 139623169) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxybenzoyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(3,4-dimethoxybenzoyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 139623169 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(3,4-dimethoxybenzoyl)-3,4-dihydroquinolin-2-one |
| SMILES | COc1ccc(C(=O)N2C(=O)CCc3ccccc32)cc1OC |
| InChI | InChI=1S/C18H17NO4/c1-22-15-9-7-13(11-16(15)23-2)18(21)19-14-6-4-3-5-12(14)8-10-17(19)20/h3-7,9,11H,8,10H2,1-2H3 |
| InChIKey | RSRFUWOKNBGVSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|