C17H16N2O3S — CID 670467
(3,4-dimethoxyphenyl)-(2-sulfanylidene-1,4-dihydroquinazolin-3-yl)methanone (PubChem CID 670467) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(2-sulfanylidene-1,4-dihydroquinazolin-3-yl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(2-sulfanylidene-1,4-dihydroquinazolin-3-yl)methanone |
|---|---|
| PubChem CID | 670467 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(2-sulfanylidene-1,4-dihydroquinazolin-3-yl)methanone |
| SMILES | COc1ccc(C(=O)N2Cc3ccccc3NC2=S)cc1OC |
| InChI | InChI=1S/C17H16N2O3S/c1-21-14-8-7-11(9-15(14)22-2)16(20)19-10-12-5-3-4-6-13(12)18-17(19)23/h3-9H,10H2,1-2H3,(H,18,23) |
| InChIKey | AKDIPSZQEUMBSI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|