C23H26N2O2 — CID 10642420
1-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one (PubChem CID 10642420) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 10642420 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)cc1C |
| InChI | InChI=1S/C23H26N2O2/c1-16-7-8-19(15-17(16)2)23(27)24-13-11-20(12-14-24)25-21-6-4-3-5-18(21)9-10-22(25)26/h3-8,15,20H,9-14H2,1-2H3 |
| InChIKey | KRMWJJDSEHCZDN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |