C21H20Cl2N2O2 — CID 10621180
1-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one (PubChem CID 10621180) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 10621180 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-3,4-dihydroquinolin-2-one |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCC(N2C(=O)CCc3ccccc32)CC1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c22-17-7-5-15(13-18(17)23)21(27)24-11-9-16(10-12-24)25-19-4-2-1-3-14(19)6-8-20(25)26/h1-5,7,13,16H,6,8-12H2 |
| InChIKey | AGLBWEVPDFBGNH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |