C25H26N2O6 — CID 10694843
[3-acetyloxy-5-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenyl] acetate (PubChem CID 10694843) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is [3-acetyloxy-5-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 10694843 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [3-acetyloxy-5-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C25H26N2O6/c1-16(28)32-21-13-19(14-22(15-21)33-17(2)29)25(31)26-11-9-20(10-12-26)27-23-6-4-3-5-18(23)7-8-24(27)30/h3-6,13-15,20H,7-12H2,1-2H3 |
| InChIKey | GUSRWVFWBKIASS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|