C33H47N3O4 — CID 19031021
1-[1-[4-[8-(diethylamino)-7-hydroxyoctoxy]benzoyl]piperidin-4-yl]-3,4-dihydroquinolin-2-one (PubChem CID 19031021) has the molecular formula C33H47N3O4 and a molecular weight of 549.76 g/mol. Its IUPAC name is 1-[1-[4-[8-(diethylamino)-7-hydroxyoctoxy]benzoyl]piperidin-4-yl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[1-[4-[8-(diethylamino)-7-hydroxyoctoxy]benzoyl]piperidin-4-yl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 19031021 |
| Molecular Formula | C33H47N3O4 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | 1-[1-[4-[8-(diethylamino)-7-hydroxyoctoxy]benzoyl]piperidin-4-yl]-3,4-dihydroquinolin-2-one |
| SMILES | CCN(CC)CC(O)CCCCCCOc1ccc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C33H47N3O4/c1-3-34(4-2)25-29(37)12-7-5-6-10-24-40-30-17-14-27(15-18-30)33(39)35-22-20-28(21-23-35)36-31-13-9-8-11-26(31)16-19-32(36)38/h8-9,11,13-15,17-18,28-29,37H,3-7,10,12,16,19-25H2,1-2H3 |
| InChIKey | DUELXLLYXQPHON-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|