C30H38N4O3 — CID 70048372
3-[methyl-[1-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentyl]amino]propanenitrile (PubChem CID 70048372) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is 3-[methyl-[1-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentyl]amino]propanenitrile.
| Compound Name | 3-[methyl-[1-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentyl]amino]propanenitrile |
|---|---|
| PubChem CID | 70048372 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 3-[methyl-[1-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentyl]amino]propanenitrile |
| SMILES | CCCCC(Oc1ccc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)cc1)N(C)CCC#N |
| InChI | InChI=1S/C30H38N4O3/c1-3-4-10-29(32(2)20-7-19-31)37-26-14-11-24(12-15-26)30(36)33-21-17-25(18-22-33)34-27-9-6-5-8-23(27)13-16-28(34)35/h5-6,8-9,11-12,14-15,25,29H,3-4,7,10,13,16-18,20-22H2,1-2H3 |
| InChIKey | RMWQOQUNDAVFSI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|