C29H36N2O6 — CID 10553681
ethyl 5-[3-methoxy-4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentanoate (PubChem CID 10553681) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is ethyl 5-[3-methoxy-4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentanoate.
| Compound Name | ethyl 5-[3-methoxy-4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 10553681 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | ethyl 5-[3-methoxy-4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1ccc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)c(OC)c1 |
| InChI | InChI=1S/C29H36N2O6/c1-3-36-28(33)10-6-7-19-37-23-12-13-24(26(20-23)35-2)29(34)30-17-15-22(16-18-30)31-25-9-5-4-8-21(25)11-14-27(31)32/h4-5,8-9,12-13,20,22H,3,6-7,10-11,14-19H2,1-2H3 |
| InChIKey | GKRARZAQTVCHLG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|