C13H18IN — CID 170253488
4-iodo-2,3,5,6,7,8-hexahydro-1H-4-benzazecine (PubChem CID 170253488) has the molecular formula C13H18IN and a molecular weight of 315.20 g/mol. Its IUPAC name is 4-iodo-2,3,5,6,7,8-hexahydro-1H-4-benzazecine.
| Compound Name | 4-iodo-2,3,5,6,7,8-hexahydro-1H-4-benzazecine |
|---|---|
| PubChem CID | 170253488 |
| Molecular Formula | C13H18IN |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-iodo-2,3,5,6,7,8-hexahydro-1H-4-benzazecine |
| SMILES | IN1CCCCc2ccccc2CCC1 |
| InChI | InChI=1S/C13H18IN/c14-15-10-4-3-8-12-6-1-2-7-13(12)9-5-11-15/h1-2,6-7H,3-5,8-11H2 |
| InChIKey | NEEBIYFEYNFYIH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|