C14H18O — CID 172707139
methanol;2,3,4,9-tetrahydro-1H-fluorene (PubChem CID 172707139) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is methanol;2,3,4,9-tetrahydro-1H-fluorene.
| Compound Name | methanol;2,3,4,9-tetrahydro-1H-fluorene |
|---|---|
| PubChem CID | 172707139 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | methanol;2,3,4,9-tetrahydro-1H-fluorene |
| SMILES | CO.c1ccc2c(c1)CC1=C2CCCC1 |
| InChI | InChI=1S/C13H14.CH4O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h1,3,5,7H,2,4,6,8-9H2;2H,1H3 |
| InChIKey | DSXPRCXSZTWNSX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |