C14H17N — CID 118332594
2-ethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 118332594) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-ethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | 2-ethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 118332594 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-ethyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | CCN1CCC2=C(Cc3ccccc32)C1 |
| InChI | InChI=1S/C14H17N/c1-2-15-8-7-14-12(10-15)9-11-5-3-4-6-13(11)14/h3-6H,2,7-10H2,1H3 |
| InChIKey | IQKBHNRWRHZTBF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |