C12H18N2 — CID 82581532
(2-ethyl-3,4-dihydro-1H-isoquinolin-5-yl)methanamine (PubChem CID 82581532) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2-ethyl-3,4-dihydro-1H-isoquinolin-5-yl)methanamine.
| Compound Name | (2-ethyl-3,4-dihydro-1H-isoquinolin-5-yl)methanamine |
|---|---|
| PubChem CID | 82581532 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (2-ethyl-3,4-dihydro-1H-isoquinolin-5-yl)methanamine |
| SMILES | CCN1CCc2c(CN)cccc2C1 |
| InChI | InChI=1S/C12H18N2/c1-2-14-7-6-12-10(8-13)4-3-5-11(12)9-14/h3-5H,2,6-9,13H2,1H3 |
| InChIKey | GYHVMXNZJPWFKP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |