About (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine
(6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine (PubChem CID 82505660) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine.
Molecular Properties
| Compound Name | (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine |
| PubChem CID | 82505660 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine |
| SMILES | CCN1CCc2c(CN)csc2C1 |
| InChI | InChI=1S/C10H16N2S/c1-2-12-4-3-9-8(5-11)7-13-10(9)6-12/h7H,2-6,11H2,1H3 |
| InChIKey | LHJDTLKHGLACCB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine?
The IUPAC name of (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine (CID 82505660) is (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine.
What is the SMILES notation for (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine?
The canonical SMILES for (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine is CCN1CCc2c(CN)csc2C1.
What is the InChIKey of (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine?
The InChIKey is LHJDTLKHGLACCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-2-12-4-3-9-8(5-11)7-13-10(9)6-12/h7H,2-6,11H2,1H3.
What are the key properties of (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine?
(6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine has a molecular weight of 196.32 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methanamine is sourced from PubChem (CID 82505660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).