C23H26 — CID 123798005
ethane;pentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene (PubChem CID 123798005) has the molecular formula C23H26 and a molecular weight of 302.46 g/mol. Its IUPAC name is ethane;pentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene.
| Compound Name | ethane;pentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
|---|---|
| PubChem CID | 123798005 |
| Molecular Formula | C23H26 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | ethane;pentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
| SMILES | CC.CC.c1ccc2c(c1)CC1=C2CC2=C1Cc1ccccc12 |
| InChI | InChI=1S/C19H14.2C2H6/c1-3-7-14-12(5-1)9-16-17-10-13-6-2-4-8-15(13)19(17)11-18(14)16;2*1-2/h1-8H,9-11H2;2*1-2H3 |
| InChIKey | UHEISDRHLKRNHK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |