C13H18 — CID 54108652
2,3-dimethyl-1H-indene;ethane (PubChem CID 54108652) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2,3-dimethyl-1H-indene;ethane.
| Compound Name | 2,3-dimethyl-1H-indene;ethane |
|---|---|
| PubChem CID | 54108652 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2,3-dimethyl-1H-indene;ethane |
| SMILES | CC.CC1=C(C)c2ccccc2C1 |
| InChI | InChI=1S/C11H12.C2H6/c1-8-7-10-5-3-4-6-11(10)9(8)2;1-2/h3-6H,7H2,1-2H3;1-2H3 |
| InChIKey | NFNJYSZMRBOJME-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |