C11H12Cl2Zr — CID 174258147
dichlorozirconium;2,3-dimethyl-1H-indene (PubChem CID 174258147) has the molecular formula C11H12Cl2Zr and a molecular weight of 306.35 g/mol. Its IUPAC name is dichlorozirconium;2,3-dimethyl-1H-indene.
| Compound Name | dichlorozirconium;2,3-dimethyl-1H-indene |
|---|---|
| PubChem CID | 174258147 |
| Molecular Formula | C11H12Cl2Zr |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | dichlorozirconium;2,3-dimethyl-1H-indene |
| SMILES | CC1=C(C)c2ccccc2C1.Cl[Zr]Cl |
| InChI | InChI=1S/C11H12.2ClH.Zr/c1-8-7-10-5-3-4-6-11(10)9(8)2;;;/h3-6H,7H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KAQBBTSYKVRCBC-UHFFFAOYSA-L |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |