C11H13Li — CID 174422478
lithium;2,3-dimethyl-1H-indene;hydride (PubChem CID 174422478) has the molecular formula C11H13Li and a molecular weight of 152.17 g/mol. Its IUPAC name is lithium;2,3-dimethyl-1H-indene;hydride.
| Compound Name | lithium;2,3-dimethyl-1H-indene;hydride |
|---|---|
| PubChem CID | 174422478 |
| Molecular Formula | C11H13Li |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | lithium;2,3-dimethyl-1H-indene;hydride |
| SMILES | CC1=C(C)c2ccccc2C1.[H-].[Li+] |
| InChI | InChI=1S/C11H12.Li.H/c1-8-7-10-5-3-4-6-11(10)9(8)2;;/h3-6H,7H2,1-2H3;;/q;+1;-1 |
| InChIKey | FQBZYTLIUQJAAD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |