C19H14 — CID 158653199
pentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene (PubChem CID 158653199) has the molecular formula C19H14 and a molecular weight of 242.32 g/mol. Its IUPAC name is pentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene.
| Compound Name | pentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene |
|---|---|
| PubChem CID | 158653199 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | pentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene |
| SMILES | c1ccc2c(c1)CC1=C2CC2=C1c1ccccc1C2 |
| InChI | InChI=1S/C19H14/c1-3-7-15-13(6-1)10-18-17(15)11-14-9-12-5-2-4-8-16(12)19(14)18/h1-8H,9-11H2 |
| InChIKey | OHMNOVQGCQSQIO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |